C17H17F5N6O3S — CID 165393986
N-ethyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 165393986) has the molecular formula C17H17F5N6O3S and a molecular weight of 480.42 g/mol. Its IUPAC name is N-ethyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-ethyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 165393986 |
| Molecular Formula | C17H17F5N6O3S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-ethyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCNc1ccnc2c(-c3cnc(OCC(F)(F)C(F)(F)F)cn3)c(S(=O)(=O)CC)nn12 |
| InChI | InChI=1S/C17H17F5N6O3S/c1-3-23-11-5-6-24-14-13(15(27-28(11)14)32(29,30)4-2)10-7-26-12(8-25-10)31-9-16(18,19)17(20,21)22/h5-8,23H,3-4,9H2,1-2H3 |
| InChIKey | QKNNYXHQMMBGAO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|