C17H13F5N8O3S — CID 165393991
2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-(1,2,4-triazol-1-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 165393991) has the molecular formula C17H13F5N8O3S and a molecular weight of 504.40 g/mol. Its IUPAC name is 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-(1,2,4-triazol-1-yl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-(1,2,4-triazol-1-yl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165393991 |
| Molecular Formula | C17H13F5N8O3S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-(1,2,4-triazol-1-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2c(-n3cncn3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H13F5N8O3S/c1-2-34(31,32)15-13(14-24-4-3-12(30(14)28-15)29-9-23-8-27-29)10-5-26-11(6-25-10)33-7-16(18,19)17(20,21)22/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | ROUZLNVPICRPPU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 130.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|