C18H12F8N8O3S — CID 165393993
2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazolo[1,5-a]pyrimidine (PubChem CID 165393993) has the molecular formula C18H12F8N8O3S and a molecular weight of 572.40 g/mol. Its IUPAC name is 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165393993 |
| Molecular Formula | C18H12F8N8O3S |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2c(-n3cnc(C(F)(F)F)n3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H12F8N8O3S/c1-2-38(35,36)14-12(9-5-29-10(6-28-9)37-7-16(19,20)18(24,25)26)13-27-4-3-11(34(13)31-14)33-8-30-15(32-33)17(21,22)23/h3-6,8H,2,7H2,1H3 |
| InChIKey | BSSYISYYWSGOHF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 130.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|