C19H17F5N6O2S — CID 165393996
N-[2-ethylsulfanyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]cyclopropanecarboxamide (PubChem CID 165393996) has the molecular formula C19H17F5N6O2S and a molecular weight of 488.44 g/mol. Its IUPAC name is N-[2-ethylsulfanyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]cyclopropanecarboxamide.
| Compound Name | N-[2-ethylsulfanyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 165393996 |
| Molecular Formula | C19H17F5N6O2S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[2-ethylsulfanyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]cyclopropanecarboxamide |
| SMILES | CCSc1nn2c(NC(=O)C3CC3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H17F5N6O2S/c1-2-33-17-14(11-7-27-13(8-26-11)32-9-18(20,21)19(22,23)24)15-25-6-5-12(30(15)29-17)28-16(31)10-3-4-10/h5-8,10H,2-4,9H2,1H3,(H,28,31) |
| InChIKey | ABBKYFCMPUUNJC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|