C8H6ClF5N2O — CID 165393997
2-(chloromethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyrazine (PubChem CID 165393997) has the molecular formula C8H6ClF5N2O and a molecular weight of 276.59 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyrazine.
| Compound Name | 2-(chloromethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyrazine |
|---|---|
| PubChem CID | 165393997 |
| Molecular Formula | C8H6ClF5N2O |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-(chloromethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyrazine |
| SMILES | FC(F)(F)C(F)(F)COc1cnc(CCl)cn1 |
| InChI | InChI=1S/C8H6ClF5N2O/c9-1-5-2-16-6(3-15-5)17-4-7(10,11)8(12,13)14/h2-3H,1,4H2 |
| InChIKey | DIZUTOHZDBKQGQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|