C19H14F5N7O3S — CID 165393998
2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-pyrimidin-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 165393998) has the molecular formula C19H14F5N7O3S and a molecular weight of 515.42 g/mol. Its IUPAC name is 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-pyrimidin-2-ylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-pyrimidin-2-ylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165393998 |
| Molecular Formula | C19H14F5N7O3S |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-7-pyrimidin-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2c(-c3ncccn3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H14F5N7O3S/c1-2-35(32,33)17-14(11-8-29-13(9-28-11)34-10-18(20,21)19(22,23)24)16-27-7-4-12(31(16)30-17)15-25-5-3-6-26-15/h3-9H,2,10H2,1H3 |
| InChIKey | BZILWYCRNOMUFV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 125.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|