C17H14F8N6O3S — CID 165393999
2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 165393999) has the molecular formula C17H14F8N6O3S and a molecular weight of 534.39 g/mol. Its IUPAC name is 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 165393999 |
| Molecular Formula | C17H14F8N6O3S |
| Molecular Weight | 534.39 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-(2,2,2-trifluoroethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CCS(=O)(=O)c1nn2ccc(NCC(F)(F)F)nc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H14F8N6O3S/c1-2-35(32,33)14-12(13-29-10(3-4-31(13)30-14)28-7-16(20,21)22)9-5-27-11(6-26-9)34-8-15(18,19)17(23,24)25/h3-6H,2,7-8H2,1H3,(H,28,29) |
| InChIKey | XDEVSRZDSJIWCE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|