About N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine
N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine (PubChem CID 165394201) has the molecular formula C10H15BrIN3
and a molecular weight of 384.06 g/mol. Its IUPAC name is N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine |
| PubChem CID | 165394201 |
| Molecular Formula | C10H15BrIN3 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine |
| SMILES | CCN(CCN(C)I)c1ccc(Br)cn1 |
| InChI | InChI=1S/C10H15BrIN3/c1-3-15(7-6-14(2)12)10-5-4-9(11)8-13-10/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | RBVCLOPZGNZLGX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine?
The IUPAC name of N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine (CID 165394201) is N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine.
What is the SMILES notation for N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine?
The canonical SMILES for N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine is CCN(CCN(C)I)c1ccc(Br)cn1.
What is the InChIKey of N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine?
The InChIKey is RBVCLOPZGNZLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrIN3/c1-3-15(7-6-14(2)12)10-5-4-9(11)8-13-10/h4-5,8H,3,6-7H2,1-2H3.
What are the key properties of N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine?
N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine has a molecular weight of 384.06 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine is sourced from PubChem (CID 165394201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).