C10H15BrIN3 — CID 165394201
N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine (PubChem CID 165394201) has the molecular formula C10H15BrIN3 and a molecular weight of 384.06 g/mol. Its IUPAC name is N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine.
| Compound Name | N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 165394201 |
| Molecular Formula | C10H15BrIN3 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | N'-(5-bromo-2-pyridinyl)-N'-ethyl-N-iodo-N-methylethane-1,2-diamine |
| SMILES | CCN(CCN(C)I)c1ccc(Br)cn1 |
| InChI | InChI=1S/C10H15BrIN3/c1-3-15(7-6-14(2)12)10-5-4-9(11)8-13-10/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | RBVCLOPZGNZLGX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|