C27H25N3O4 — CID 165394402
6,7-dimethoxy-4-(4-piperazin-1-ylquinolin-7-yl)-1H-benzo[f][2]benzofuran-3-one (PubChem CID 165394402) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(4-piperazin-1-ylquinolin-7-yl)-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | 6,7-dimethoxy-4-(4-piperazin-1-ylquinolin-7-yl)-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 165394402 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 6,7-dimethoxy-4-(4-piperazin-1-ylquinolin-7-yl)-1H-benzo[f][2]benzofuran-3-one |
| SMILES | COc1cc2cc3c(c(-c4ccc5c(N6CCNCC6)ccnc5c4)c2cc1OC)C(=O)OC3 |
| InChI | InChI=1S/C27H25N3O4/c1-32-23-13-17-11-18-15-34-27(31)26(18)25(20(17)14-24(23)33-2)16-3-4-19-21(12-16)29-6-5-22(19)30-9-7-28-8-10-30/h3-6,11-14,28H,7-10,15H2,1-2H3 |
| InChIKey | YVSLVGVJLHPTRU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |