C13H15FN4OS — CID 165394866
[(3aS,4S,5R,6aR)-4-azido-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 165394866) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is [(3aS,4S,5R,6aR)-4-azido-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(3aS,4S,5R,6aR)-4-azido-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 165394866 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(3aS,4S,5R,6aR)-4-azido-5-fluoro-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@@H]3C[C@@H](F)[C@@H](N=[N+]=[N-])[C@@H]3C2)s1 |
| InChI | InChI=1S/C13H15FN4OS/c1-7-2-3-11(20-7)13(19)18-5-8-4-10(14)12(16-17-15)9(8)6-18/h2-3,8-10,12H,4-6H2,1H3/t8-,9+,10+,12-/m0/s1 |
| InChIKey | XXKACOHUVJECHA-XNDJQWLSSA-N |
| XLogP | 3.17 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|