C23H28FN7O5 — CID 165395388
(2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-fluorophenyl)prop-2-enyl]amino]butanoic acid (PubChem CID 165395388) has the molecular formula C23H28FN7O5 and a molecular weight of 501.52 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-fluorophenyl)prop-2-enyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-fluorophenyl)prop-2-enyl]amino]butanoic acid |
|---|---|
| PubChem CID | 165395388 |
| Molecular Formula | C23H28FN7O5 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-fluorophenyl)prop-2-enyl]amino]butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(C/C=C/c2ccc(F)cc2)CC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H28FN7O5/c24-14-5-3-13(4-6-14)2-1-8-30(9-7-15(25)23(34)35)10-16-18(32)19(33)22(36-16)31-12-29-17-20(26)27-11-28-21(17)31/h1-6,11-12,15-16,18-19,22,32-33H,7-10,25H2,(H,34,35)(H2,26,27,28)/b2-1+/t15-,16+,18+,19+,22+/m0/s1 |
| InChIKey | PPFBYDOMKLGSPH-SUIOFXLQSA-N |
| XLogP | -0.02 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |