About CID 165395578
CID 165395578 (PubChem CID 165395578) has the molecular formula C30H39BFN4O2PS+
and a molecular weight of 580.52 g/mol.
Molecular Properties
| Compound Name | CID 165395578 |
| PubChem CID | 165395578 |
| Molecular Formula | C30H39BFN4O2PS+ |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | — |
| SMILES | CC.CC[B]c1ccc2[nH]c(C(=O)NCCc3cc([P+]4(CC)NO4)c(C)c(-c4ccc(F)cc4)n3)cc2c1.CS |
| InChI | InChI=1S/C27H28BFN4O2P.C2H6.CH4S/c1-4-28-20-8-11-23-19(14-20)15-24(32-23)27(34)30-13-12-22-16-25(36(5-2)33-35-36)17(3)26(31-22)18-6-9-21(29)10-7-18;2*1-2/h6-11,14-16,33H,4-5,12-13H2,1-3H3,(H-,30,32,34);1-2H3;2H,1H3/p+1 |
| InChIKey | HQRXXCJAVBGOMO-UHFFFAOYSA-O |
| XLogP | 6.02 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 165395578 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165395578?
The IUPAC name of CID 165395578 (CID 165395578) is not available.
What is the SMILES notation for CID 165395578?
The canonical SMILES for CID 165395578 is CC.CC[B]c1ccc2[nH]c(C(=O)NCCc3cc([P+]4(CC)NO4)c(C)c(-c4ccc(F)cc4)n3)cc2c1.CS.
What is the InChIKey of CID 165395578?
The InChIKey is HQRXXCJAVBGOMO-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H28BFN4O2P.C2H6.CH4S/c1-4-28-20-8-11-23-19(14-20)15-24(32-23)27(34)30-13-12-22-16-25(36(5-2)33-35-36)17(3)26(31-22)18-6-9-21(29)10-7-18;2*1-2/h6-11,14-16,33H,4-5,12-13H2,1-3H3,(H-,30,32,34);1-2H3;2H,1H3/p+1.
What are the key properties of CID 165395578?
CID 165395578 has a molecular weight of 580.52 g/mol, XLogP of 6.02, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165395578 is sourced from PubChem (CID 165395578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).