C14H13F2N3S2 — CID 165395975
S-[4-(7,7-difluoro-2-methylsulfanyl-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)phenyl]thiohydroxylamine (PubChem CID 165395975) has the molecular formula C14H13F2N3S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is S-[4-(7,7-difluoro-2-methylsulfanyl-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)phenyl]thiohydroxylamine.
| Compound Name | S-[4-(7,7-difluoro-2-methylsulfanyl-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 165395975 |
| Molecular Formula | C14H13F2N3S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | S-[4-(7,7-difluoro-2-methylsulfanyl-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)phenyl]thiohydroxylamine |
| SMILES | CSc1nc(-c2ccc(SN)cc2)c2c(n1)C(F)(F)CC2 |
| InChI | InChI=1S/C14H13F2N3S2/c1-20-13-18-11(8-2-4-9(21-17)5-3-8)10-6-7-14(15,16)12(10)19-13/h2-5H,6-7,17H2,1H3 |
| InChIKey | GUZGXPQOJBPNLQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|