About [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate
[1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate (PubChem CID 165396877) has the molecular formula C17H16ClN3O2
and a molecular weight of 329.79 g/mol. Its IUPAC name is [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate.
Molecular Properties
| Compound Name | [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate |
| PubChem CID | 165396877 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate |
| SMILES | O=C(OC1CN(c2nc(Cl)c3c(n2)CCC3)C1)c1ccccc1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-15-13-7-4-8-14(13)19-17(20-15)21-9-12(10-21)23-16(22)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2 |
| InChIKey | SXDXZECYTKCJBI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate?
The IUPAC name of [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate (CID 165396877) is [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate.
What is the SMILES notation for [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate?
The canonical SMILES for [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate is O=C(OC1CN(c2nc(Cl)c3c(n2)CCC3)C1)c1ccccc1.
What is the InChIKey of [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate?
The InChIKey is SXDXZECYTKCJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O2/c18-15-13-7-4-8-14(13)19-17(20-15)21-9-12(10-21)23-16(22)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2.
What are the key properties of [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate?
[1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate has a molecular weight of 329.79 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)azetidin-3-yl] benzoate is sourced from PubChem (CID 165396877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).