C14H18Cl2N2O2 — CID 165397487
(2R)-2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]butanamide (PubChem CID 165397487) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is (2R)-2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]butanamide.
| Compound Name | (2R)-2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 165397487 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2R)-2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]butanamide |
| SMILES | CC[C@@H](C(N)=O)[C@H]1CN[C@@H](c2c(O)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-2-8(14(17)20)7-5-10(18-6-7)12-11(19)4-3-9(15)13(12)16/h3-4,7-8,10,18-19H,2,5-6H2,1H3,(H2,17,20)/t7-,8-,10-/m1/s1 |
| InChIKey | QDTMMSZHUQYINK-NQMVMOMDSA-N |
| XLogP | 2.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|