C13H16Cl2N2O2 — CID 165397497
2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]-N-methylacetamide (PubChem CID 165397497) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]-N-methylacetamide.
| Compound Name | 2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 165397497 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[(3S,5R)-5-(2,3-dichloro-6-hydroxyphenyl)pyrrolidin-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@H]1CN[C@@H](c2c(O)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-16-11(19)5-7-4-9(17-6-7)12-10(18)3-2-8(14)13(12)15/h2-3,7,9,17-18H,4-6H2,1H3,(H,16,19)/t7-,9+/m0/s1 |
| InChIKey | IXRVSGJGADYXLN-IONNQARKSA-N |
| XLogP | 2.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|