About 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide
2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide (PubChem CID 165397541) has the molecular formula C12H14Cl2N2O2
and a molecular weight of 289.16 g/mol. Its IUPAC name is 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide |
| PubChem CID | 165397541 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide |
| SMILES | NC(=O)CC1CN[C@@H](c2cc(Cl)c(Cl)cc2O)C1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c13-8-3-7(11(17)4-9(8)14)10-1-6(5-16-10)2-12(15)18/h3-4,6,10,16-17H,1-2,5H2,(H2,15,18)/t6?,10-/m1/s1 |
| InChIKey | QCVXCCRKWXPYMA-PHUNFMHTSA-N |
| XLogP | 2.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide?
The IUPAC name of 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide (CID 165397541) is 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide.
What is the SMILES notation for 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide?
The canonical SMILES for 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide is NC(=O)CC1CN[C@@H](c2cc(Cl)c(Cl)cc2O)C1.
What is the InChIKey of 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide?
The InChIKey is QCVXCCRKWXPYMA-PHUNFMHTSA-N. The full InChI is InChI=1S/C12H14Cl2N2O2/c13-8-3-7(11(17)4-9(8)14)10-1-6(5-16-10)2-12(15)18/h3-4,6,10,16-17H,1-2,5H2,(H2,15,18)/t6?,10-/m1/s1.
What are the key properties of 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide?
2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide has a molecular weight of 289.16 g/mol, XLogP of 2.22, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R)-5-(4,5-dichloro-2-hydroxyphenyl)pyrrolidin-3-yl]acetamide is sourced from PubChem (CID 165397541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).