About [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane
[7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane (PubChem CID 165397694) has the molecular formula C17H29ClN2O2S
and a molecular weight of 360.95 g/mol. Its IUPAC name is [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane.
Molecular Properties
| Compound Name | [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane |
| PubChem CID | 165397694 |
| Molecular Formula | C17H29ClN2O2S |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane |
| SMILES | CCC.NCCCCCC(CSc1ccc(Cl)cc1)OC(N)=O |
| InChI | InChI=1S/C14H21ClN2O2S.C3H8/c15-11-5-7-13(8-6-11)20-10-12(19-14(17)18)4-2-1-3-9-16;1-3-2/h5-8,12H,1-4,9-10,16H2,(H2,17,18);3H2,1-2H3 |
| InChIKey | DRFQBVKDFGFRGD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane?
The IUPAC name of [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane (CID 165397694) is [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane.
What is the SMILES notation for [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane?
The canonical SMILES for [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane is CCC.NCCCCCC(CSc1ccc(Cl)cc1)OC(N)=O.
What is the InChIKey of [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane?
The InChIKey is DRFQBVKDFGFRGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClN2O2S.C3H8/c15-11-5-7-13(8-6-11)20-10-12(19-14(17)18)4-2-1-3-9-16;1-3-2/h5-8,12H,1-4,9-10,16H2,(H2,17,18);3H2,1-2H3.
What are the key properties of [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane?
[7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane has a molecular weight of 360.95 g/mol, XLogP of 4.83, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-amino-1-(4-chlorophenyl)sulfanylheptan-2-yl] carbamate;propane is sourced from PubChem (CID 165397694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).