About 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione
5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione (PubChem CID 165398099) has the molecular formula C9H13ClN2O2
and a molecular weight of 216.67 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione |
| PubChem CID | 165398099 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Cl)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C9H13ClN2O2/c1-5(2)7-6(10)8(13)12(4)9(14)11(7)3/h5H,1-4H3 |
| InChIKey | JGDKAJLPZUICFX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione?
The IUPAC name of 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione (CID 165398099) is 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione.
What is the SMILES notation for 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione?
The canonical SMILES for 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione is CC(C)c1c(Cl)c(=O)n(C)c(=O)n1C.
What is the InChIKey of 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione?
The InChIKey is JGDKAJLPZUICFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O2/c1-5(2)7-6(10)8(13)12(4)9(14)11(7)3/h5H,1-4H3.
What are the key properties of 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione?
5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione has a molecular weight of 216.67 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-dimethyl-6-propan-2-ylpyrimidine-2,4-dione is sourced from PubChem (CID 165398099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).