C24H20FN7O — CID 165398682
9-(3-aminophenyl)-2-[(2-fluoro-3-pyridinyl)amino]-7-phenyl-5,6-dihydropyrimido[4,5-d][1,3]diazepin-8-one (PubChem CID 165398682) has the molecular formula C24H20FN7O and a molecular weight of 441.47 g/mol. Its IUPAC name is 9-(3-aminophenyl)-2-[(2-fluoro-3-pyridinyl)amino]-7-phenyl-5,6-dihydropyrimido[4,5-d][1,3]diazepin-8-one.
| Compound Name | 9-(3-aminophenyl)-2-[(2-fluoro-3-pyridinyl)amino]-7-phenyl-5,6-dihydropyrimido[4,5-d][1,3]diazepin-8-one |
|---|---|
| PubChem CID | 165398682 |
| Molecular Formula | C24H20FN7O |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 9-(3-aminophenyl)-2-[(2-fluoro-3-pyridinyl)amino]-7-phenyl-5,6-dihydropyrimido[4,5-d][1,3]diazepin-8-one |
| SMILES | Nc1cccc(N2C(=O)N(c3ccccc3)CCc3cnc(Nc4cccnc4F)nc32)c1 |
| InChI | InChI=1S/C24H20FN7O/c25-21-20(10-5-12-27-21)29-23-28-15-16-11-13-31(18-7-2-1-3-8-18)24(33)32(22(16)30-23)19-9-4-6-17(26)14-19/h1-10,12,14-15H,11,13,26H2,(H,28,29,30) |
| InChIKey | LJUUMJNWKNTPCU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|