About (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride
(E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride (PubChem CID 165398693) has the molecular formula C6H17FN2O2S
and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride.
Molecular Properties
| Compound Name | (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride |
| PubChem CID | 165398693 |
| Molecular Formula | C6H17FN2O2S |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride |
| SMILES | CNS(=O)(=O)/C=C/CN(C)C.F.[H][H] |
| InChI | InChI=1S/C6H14N2O2S.FH.H2/c1-7-11(9,10)6-4-5-8(2)3;;/h4,6-7H,5H2,1-3H3;2*1H/b6-4+;; |
| InChIKey | UXBUZMKCZLEDQS-SLNOCBGISA-N |
| XLogP | 0.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride?
The IUPAC name of (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride (CID 165398693) is (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride.
What is the SMILES notation for (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride?
The canonical SMILES for (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride is CNS(=O)(=O)/C=C/CN(C)C.F.[H][H].
What is the InChIKey of (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride?
The InChIKey is UXBUZMKCZLEDQS-SLNOCBGISA-N. The full InChI is InChI=1S/C6H14N2O2S.FH.H2/c1-7-11(9,10)6-4-5-8(2)3;;/h4,6-7H,5H2,1-3H3;2*1H/b6-4+;;.
What are the key properties of (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride?
(E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride has a molecular weight of 200.28 g/mol, XLogP of 0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(dimethylamino)-N-methylprop-1-ene-1-sulfonamide;molecular hydrogen;hydrofluoride is sourced from PubChem (CID 165398693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).