C44H58N6O2 — CID 165399069
2-(2-adamantyl)-N-[7-[3-[7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl]phenyl]heptyl]acetamide (PubChem CID 165399069) has the molecular formula C44H58N6O2 and a molecular weight of 702.99 g/mol. Its IUPAC name is 2-(2-adamantyl)-N-[7-[3-[7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl]phenyl]heptyl]acetamide.
| Compound Name | 2-(2-adamantyl)-N-[7-[3-[7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl]phenyl]heptyl]acetamide |
|---|---|
| PubChem CID | 165399069 |
| Molecular Formula | C44H58N6O2 |
| Molecular Weight | 702.99 g/mol |
| Exact Mass | 702.46 |
| IUPAC Name | 2-(2-adamantyl)-N-[7-[3-[7-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl]phenyl]heptyl]acetamide |
| SMILES | Cc1nn2c(N3CCN(CCO)CC3)cc(-c3cccc(CCCCCCCNC(=O)CC4C5CC6CC(C5)CC4C6)c3)nc2c1-c1ccccc1 |
| InChI | InChI=1S/C44H58N6O2/c1-31-43(35-13-7-5-8-14-35)44-46-40(30-42(50(44)47-31)49-19-17-48(18-20-49)21-22-51)36-15-10-12-32(24-36)11-6-3-2-4-9-16-45-41(52)29-39-37-25-33-23-34(27-37)28-38(39)26-33/h5,7-8,10,12-15,24,30,33-34,37-39,51H,2-4,6,9,11,16-23,25-29H2,1H3,(H,45,52) |
| InChIKey | MJFPJBBRBSQSMF-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.99 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|