About CID 165399540
CID 165399540 (PubChem CID 165399540) has the molecular formula C7H9AsN2
and a molecular weight of 196.08 g/mol.
Molecular Properties
| Compound Name | CID 165399540 |
| PubChem CID | 165399540 |
| Molecular Formula | C7H9AsN2 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | — |
| SMILES | Cc1nnc(C)c([As])c1C |
| InChI | InChI=1S/C7H9AsN2/c1-4-5(2)9-10-6(3)7(4)8/h1-3H3 |
| InChIKey | OMWAWXCKEKPRDV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 165399540 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165399540?
The IUPAC name of CID 165399540 (CID 165399540) is not available.
What is the SMILES notation for CID 165399540?
The canonical SMILES for CID 165399540 is Cc1nnc(C)c([As])c1C.
What is the InChIKey of CID 165399540?
The InChIKey is OMWAWXCKEKPRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9AsN2/c1-4-5(2)9-10-6(3)7(4)8/h1-3H3.
What are the key properties of CID 165399540?
CID 165399540 has a molecular weight of 196.08 g/mol, XLogP of 0.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165399540 is sourced from PubChem (CID 165399540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).