C17H29N3 — CID 165400025
ethane;1-(6-ethyl-4-methyl-2-pyridinyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 165400025) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is ethane;1-(6-ethyl-4-methyl-2-pyridinyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | ethane;1-(6-ethyl-4-methyl-2-pyridinyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 165400025 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | ethane;1-(6-ethyl-4-methyl-2-pyridinyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CC.CCc1cc(C)cc(N2CCC3CN(C)CC32)n1 |
| InChI | InChI=1S/C15H23N3.C2H6/c1-4-13-7-11(2)8-15(16-13)18-6-5-12-9-17(3)10-14(12)18;1-2/h7-8,12,14H,4-6,9-10H2,1-3H3;1-2H3 |
| InChIKey | PSNAPEBERMZOTQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |