C32H34Cl2N4O4 — CID 165400425
N-[(5S)-5-[[2-(3,4-dichlorophenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide (PubChem CID 165400425) has the molecular formula C32H34Cl2N4O4 and a molecular weight of 609.55 g/mol. Its IUPAC name is N-[(5S)-5-[[2-(3,4-dichlorophenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide.
| Compound Name | N-[(5S)-5-[[2-(3,4-dichlorophenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 165400425 |
| Molecular Formula | C32H34Cl2N4O4 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | N-[(5S)-5-[[2-(3,4-dichlorophenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)Cc1ccc(Cl)c(Cl)c1)C(=O)N1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C32H34Cl2N4O4/c1-2-29(39)35-15-6-5-12-28(36-30(40)21-22-13-14-26(33)27(34)20-22)32(42)38-18-16-37(17-19-38)31(41)25-11-7-9-23-8-3-4-10-24(23)25/h2-4,7-11,13-14,20,28H,1,5-6,12,15-19,21H2,(H,35,39)(H,36,40)/t28-/m0/s1 |
| InChIKey | CYHYKVLXCWRLBW-NDEPHWFRSA-N |
| XLogP | 4.63 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|