C15H17FN4O3 — CID 165401287
ethyl 6-(4-fluoro-3-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate (PubChem CID 165401287) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is ethyl 6-(4-fluoro-3-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate.
| Compound Name | ethyl 6-(4-fluoro-3-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 165401287 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | ethyl 6-(4-fluoro-3-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2n(n1)CC(c1ccc(F)c(OC)c1)NC2 |
| InChI | InChI=1S/C15H17FN4O3/c1-3-23-15(21)14-18-13-7-17-11(8-20(13)19-14)9-4-5-10(16)12(6-9)22-2/h4-6,11,17H,3,7-8H2,1-2H3 |
| InChIKey | XCUSFMCWUADQJO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |