C10H8F3N3 — CID 165402962
[1-(2,2,2-trifluoroethyl)pyrrolo[2,3-c]pyridin-5-yl]methanimine (PubChem CID 165402962) has the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)pyrrolo[2,3-c]pyridin-5-yl]methanimine.
| Compound Name | [1-(2,2,2-trifluoroethyl)pyrrolo[2,3-c]pyridin-5-yl]methanimine |
|---|---|
| PubChem CID | 165402962 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)pyrrolo[2,3-c]pyridin-5-yl]methanimine |
| SMILES | [H]/N=C/c1cc2ccn(CC(F)(F)F)c2cn1 |
| InChI | InChI=1S/C10H8F3N3/c11-10(12,13)6-16-2-1-7-3-8(4-14)15-5-9(7)16/h1-5,14H,6H2/b14-4+ |
| InChIKey | FIKFJEYPLBMSPL-LNKIKWGQSA-N |
| XLogP | 2.60 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|