About 4-fluoro-2,3-dimethylhex-2-ene
4-fluoro-2,3-dimethylhex-2-ene (PubChem CID 165403625) has the molecular formula C8H15F
and a molecular weight of 130.21 g/mol. Its IUPAC name is 4-fluoro-2,3-dimethylhex-2-ene.
Molecular Properties
| Compound Name | 4-fluoro-2,3-dimethylhex-2-ene |
| PubChem CID | 165403625 |
| Molecular Formula | C8H15F |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 4-fluoro-2,3-dimethylhex-2-ene |
| SMILES | CCC(F)C(C)=C(C)C |
| InChI | InChI=1S/C8H15F/c1-5-8(9)7(4)6(2)3/h8H,5H2,1-4H3 |
| InChIKey | JQIKCMYDUWQBBG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2,3-dimethylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,3-dimethylhex-2-ene?
The IUPAC name of 4-fluoro-2,3-dimethylhex-2-ene (CID 165403625) is 4-fluoro-2,3-dimethylhex-2-ene.
What is the SMILES notation for 4-fluoro-2,3-dimethylhex-2-ene?
The canonical SMILES for 4-fluoro-2,3-dimethylhex-2-ene is CCC(F)C(C)=C(C)C.
What is the InChIKey of 4-fluoro-2,3-dimethylhex-2-ene?
The InChIKey is JQIKCMYDUWQBBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F/c1-5-8(9)7(4)6(2)3/h8H,5H2,1-4H3.
What are the key properties of 4-fluoro-2,3-dimethylhex-2-ene?
4-fluoro-2,3-dimethylhex-2-ene has a molecular weight of 130.21 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3-dimethylhex-2-ene is sourced from PubChem (CID 165403625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).