About ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine
ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine (PubChem CID 165403738) has the molecular formula C20H54N4
and a molecular weight of 350.68 g/mol. Its IUPAC name is ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine.
Molecular Properties
| Compound Name | ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine |
| PubChem CID | 165403738 |
| Molecular Formula | C20H54N4 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.43 |
| IUPAC Name | ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine |
| SMILES | C.CC.CC.CC.CC.CNCCCN1CCN(CCCN)CC1 |
| InChI | InChI=1S/C11H26N4.4C2H6.CH4/c1-13-5-3-7-15-10-8-14(9-11-15)6-2-4-12;4*1-2;/h13H,2-12H2,1H3;4*1-2H3;1H4 |
| InChIKey | YTTSUEFQXBXKOQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine?
The IUPAC name of ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine (CID 165403738) is ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine.
What is the SMILES notation for ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine?
The canonical SMILES for ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine is C.CC.CC.CC.CC.CNCCCN1CCN(CCCN)CC1.
What is the InChIKey of ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine?
The InChIKey is YTTSUEFQXBXKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N4.4C2H6.CH4/c1-13-5-3-7-15-10-8-14(9-11-15)6-2-4-12;4*1-2;/h13H,2-12H2,1H3;4*1-2H3;1H4.
What are the key properties of ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine?
ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine has a molecular weight of 350.68 g/mol, XLogP of 4.30, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;3-[4-[3-(methylamino)propyl]piperazin-1-yl]propan-1-amine is sourced from PubChem (CID 165403738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).