C14H20N4O — CID 165404047
N-propan-2-yl-3-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide (PubChem CID 165404047) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-propan-2-yl-3-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide.
| Compound Name | N-propan-2-yl-3-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 165404047 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-propan-2-yl-3-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide |
| SMILES | CC(C)NC(=O)c1cccc(/C(N)=C/C=C(N)N)c1 |
| InChI | InChI=1S/C14H20N4O/c1-9(2)18-14(19)11-5-3-4-10(8-11)12(15)6-7-13(16)17/h3-9H,15-17H2,1-2H3,(H,18,19)/b12-6- |
| InChIKey | GROJSYNCCODBEU-SDQBBNPISA-N |
| XLogP | 0.88 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|