C13H15F3N4O — CID 165404066
2,3,6-trifluoro-N,N-dimethyl-4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide (PubChem CID 165404066) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 2,3,6-trifluoro-N,N-dimethyl-4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N,N-dimethyl-4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 165404066 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2,3,6-trifluoro-N,N-dimethyl-4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide |
| SMILES | CN(C)C(=O)c1c(F)cc(/C(N)=C/C=C(N)N)c(F)c1F |
| InChI | InChI=1S/C13H15F3N4O/c1-20(2)13(21)10-7(14)5-6(11(15)12(10)16)8(17)3-4-9(18)19/h3-5H,17-19H2,1-2H3/b8-3- |
| InChIKey | CKVPAZGNZJABCE-BAQGIRSFSA-N |
| XLogP | 0.86 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|