About CID 165405184
CID 165405184 (PubChem CID 165405184) has the molecular formula C25H30F5N5O2Si
and a molecular weight of 555.62 g/mol.
Molecular Properties
| Compound Name | CID 165405184 |
| PubChem CID | 165405184 |
| Molecular Formula | C25H30F5N5O2Si |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1cc(F)c(C[Si][C@@H](CNC(=O)C[C@H](c2cnc(C)nc2)C2(C(F)(F)F)CC2)N(C)C)c(F)c1 |
| InChI | InChI=1S/C25H30F5N5O2Si/c1-14-32-10-16(11-33-14)18(24(5-6-24)25(28,29)30)9-21(36)34-12-22(35(3)4)38-13-17-19(26)7-15(8-20(17)27)23(37)31-2/h7-8,10-11,18,22H,5-6,9,12-13H2,1-4H3,(H,31,37)(H,34,36)/t18-,22+/m1/s1 |
| InChIKey | NQPWHGANIPPTHA-GCJKJVERSA-N |
| XLogP | 3.15 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 165405184 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165405184?
The IUPAC name of CID 165405184 (CID 165405184) is not available.
What is the SMILES notation for CID 165405184?
The canonical SMILES for CID 165405184 is CNC(=O)c1cc(F)c(C[Si][C@@H](CNC(=O)C[C@H](c2cnc(C)nc2)C2(C(F)(F)F)CC2)N(C)C)c(F)c1.
What is the InChIKey of CID 165405184?
The InChIKey is NQPWHGANIPPTHA-GCJKJVERSA-N. The full InChI is InChI=1S/C25H30F5N5O2Si/c1-14-32-10-16(11-33-14)18(24(5-6-24)25(28,29)30)9-21(36)34-12-22(35(3)4)38-13-17-19(26)7-15(8-20(17)27)23(37)31-2/h7-8,10-11,18,22H,5-6,9,12-13H2,1-4H3,(H,31,37)(H,34,36)/t18-,22+/m1/s1.
What are the key properties of CID 165405184?
CID 165405184 has a molecular weight of 555.62 g/mol, XLogP of 3.15, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165405184 is sourced from PubChem (CID 165405184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).