C12H15F3N2O2 — CID 165405351
(3S)-3-(2-methylpyrimidin-5-yl)-4-(trifluoromethyl)hexanoic acid (PubChem CID 165405351) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is (3S)-3-(2-methylpyrimidin-5-yl)-4-(trifluoromethyl)hexanoic acid.
| Compound Name | (3S)-3-(2-methylpyrimidin-5-yl)-4-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 165405351 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3S)-3-(2-methylpyrimidin-5-yl)-4-(trifluoromethyl)hexanoic acid |
| SMILES | CCC([C@H](CC(=O)O)c1cnc(C)nc1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-3-10(12(13,14)15)9(4-11(18)19)8-5-16-7(2)17-6-8/h5-6,9-10H,3-4H2,1-2H3,(H,18,19)/t9-,10?/m1/s1 |
| InChIKey | CXYIBJZWHXYLSJ-YHMJZVADSA-N |
| XLogP | 2.93 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |