C22H29F3N4O2 — CID 165405418
N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-4-ethenylimino-4-(methylideneamino)-3-[1-(trifluoromethyl)cyclopropyl]butanamide (PubChem CID 165405418) has the molecular formula C22H29F3N4O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-4-ethenylimino-4-(methylideneamino)-3-[1-(trifluoromethyl)cyclopropyl]butanamide.
| Compound Name | N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-4-ethenylimino-4-(methylideneamino)-3-[1-(trifluoromethyl)cyclopropyl]butanamide |
|---|---|
| PubChem CID | 165405418 |
| Molecular Formula | C22H29F3N4O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-4-ethenylimino-4-(methylideneamino)-3-[1-(trifluoromethyl)cyclopropyl]butanamide |
| SMILES | C=C/N=C(\N=C)C(CC(=O)NCC(Cc1ccc(O)cc1)N(C)C)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H29F3N4O2/c1-5-27-20(26-2)18(21(10-11-21)22(23,24)25)13-19(31)28-14-16(29(3)4)12-15-6-8-17(30)9-7-15/h5-9,16,18,30H,1-2,10-14H2,3-4H3,(H,28,31)/b27-20- |
| InChIKey | MTPXLAYRVOPEJQ-OOAXWGSJSA-N |
| XLogP | 3.57 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|