C15H21FN2O4 — CID 165405604
tert-butyl N-[1-[3-fluoro-4-(nitrosomethyl)phenyl]-3-hydroxypropan-2-yl]carbamate (PubChem CID 165405604) has the molecular formula C15H21FN2O4 and a molecular weight of 312.34 g/mol. Its IUPAC name is tert-butyl N-[1-[3-fluoro-4-(nitrosomethyl)phenyl]-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-fluoro-4-(nitrosomethyl)phenyl]-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 165405604 |
| Molecular Formula | C15H21FN2O4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | tert-butyl N-[1-[3-fluoro-4-(nitrosomethyl)phenyl]-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)Cc1ccc(CN=O)c(F)c1 |
| InChI | InChI=1S/C15H21FN2O4/c1-15(2,3)22-14(20)18-12(9-19)6-10-4-5-11(8-17-21)13(16)7-10/h4-5,7,12,19H,6,8-9H2,1-3H3,(H,18,20) |
| InChIKey | RNGJPQQXPNSSEC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |