C12H15F2NO3 — CID 165405624
ethyl (6R,8S)-1',1'-difluoro-3-oxospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane]-8-carboxylate (PubChem CID 165405624) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is ethyl (6R,8S)-1',1'-difluoro-3-oxospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane]-8-carboxylate.
| Compound Name | ethyl (6R,8S)-1',1'-difluoro-3-oxospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane]-8-carboxylate |
|---|---|
| PubChem CID | 165405624 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | ethyl (6R,8S)-1',1'-difluoro-3-oxospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane]-8-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC(=O)N1C[C@]1(CC1(F)F)C2 |
| InChI | InChI=1S/C12H15F2NO3/c1-2-18-9(17)11-4-3-8(16)15(11)7-10(5-11)6-12(10,13)14/h2-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | MBIBMQJAACBRSC-MNOVXSKESA-N |
| XLogP | 1.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |