C10H17F3N2O — CID 165405780
[(6R,8aR)-2-(2,2,2-trifluoroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]methanol (PubChem CID 165405780) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is [(6R,8aR)-2-(2,2,2-trifluoroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]methanol.
| Compound Name | [(6R,8aR)-2-(2,2,2-trifluoroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]methanol |
|---|---|
| PubChem CID | 165405780 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [(6R,8aR)-2-(2,2,2-trifluoroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]methanol |
| SMILES | OC[C@H]1CC[C@@H]2CN(CC(F)(F)F)CCN21 |
| InChI | InChI=1S/C10H17F3N2O/c11-10(12,13)7-14-3-4-15-8(5-14)1-2-9(15)6-16/h8-9,16H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | KMFOHKOLOTXKOR-RKDXNWHRSA-N |
| XLogP | 0.69 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |