About 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol
2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol (PubChem CID 165405834) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol |
| PubChem CID | 165405834 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol |
| SMILES | CN1CC(F)(F)C[C@H]1C(C)(C)O |
| InChI | InChI=1S/C8H15F2NO/c1-7(2,12)6-4-8(9,10)5-11(6)3/h6,12H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | XSWDAAVFBINASA-LURJTMIESA-N |
| XLogP | 1.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol?
The IUPAC name of 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol (CID 165405834) is 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol.
What is the SMILES notation for 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol?
The canonical SMILES for 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol is CN1CC(F)(F)C[C@H]1C(C)(C)O.
What is the InChIKey of 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol?
The InChIKey is XSWDAAVFBINASA-LURJTMIESA-N. The full InChI is InChI=1S/C8H15F2NO/c1-7(2,12)6-4-8(9,10)5-11(6)3/h6,12H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol?
2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol has a molecular weight of 179.21 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]propan-2-ol is sourced from PubChem (CID 165405834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).