C31H25Cl2F5N4O3 — CID 165405844
7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-2,3-dihydroquinazolin-4-one (PubChem CID 165405844) has the molecular formula C31H25Cl2F5N4O3 and a molecular weight of 667.46 g/mol. Its IUPAC name is 7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-2,3-dihydroquinazolin-4-one.
| Compound Name | 7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-2,3-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 165405844 |
| Molecular Formula | C31H25Cl2F5N4O3 |
| Molecular Weight | 667.46 g/mol |
| Exact Mass | 666.12 |
| IUPAC Name | 7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-2,3-dihydroquinazolin-4-one |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(C)c(C(F)(F)F)c(C3=CC4=NC(Cl)NC(=O)C4=C(F)C3(F)Cl)n2)cc1 |
| InChI | InChI=1S/C31H25Cl2F5N4O3/c1-16-12-23(42(14-17-4-8-19(44-2)9-5-17)15-18-6-10-20(45-3)11-7-18)40-26(25(16)31(36,37)38)21-13-22-24(27(34)30(21,33)35)28(43)41-29(32)39-22/h4-13,29H,14-15H2,1-3H3,(H,41,43) |
| InChIKey | LEPCADIFXHFWCK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.46 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|