C7H9F2N — CID 165405920
2,2-difluoro-1,3,5,6-tetrahydropyrrolizine (PubChem CID 165405920) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is 2,2-difluoro-1,3,5,6-tetrahydropyrrolizine.
| Compound Name | 2,2-difluoro-1,3,5,6-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 165405920 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2,2-difluoro-1,3,5,6-tetrahydropyrrolizine |
| SMILES | FC1(F)CC2=CCCN2C1 |
| InChI | InChI=1S/C7H9F2N/c8-7(9)4-6-2-1-3-10(6)5-7/h2H,1,3-5H2 |
| InChIKey | TXSYUDBPRZJRDH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |