About 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol
2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol (PubChem CID 165406031) has the molecular formula C6H9BrN2OS
and a molecular weight of 237.12 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol |
| PubChem CID | 165406031 |
| Molecular Formula | C6H9BrN2OS |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol |
| SMILES | OCCNCc1scnc1Br |
| InChI | InChI=1S/C6H9BrN2OS/c7-6-5(11-4-9-6)3-8-1-2-10/h4,8,10H,1-3H2 |
| InChIKey | FNTBBATXFHOPTA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol?
The IUPAC name of 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol (CID 165406031) is 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol.
What is the SMILES notation for 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol?
The canonical SMILES for 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol is OCCNCc1scnc1Br.
What is the InChIKey of 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol?
The InChIKey is FNTBBATXFHOPTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2OS/c7-6-5(11-4-9-6)3-8-1-2-10/h4,8,10H,1-3H2.
What are the key properties of 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol?
2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol has a molecular weight of 237.12 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-1,3-thiazol-5-yl)methylamino]ethanol is sourced from PubChem (CID 165406031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).