C7H15FN2 — CID 165407712
1-fluoro-2,4,6-trimethylpiperazine (PubChem CID 165407712) has the molecular formula C7H15FN2 and a molecular weight of 146.21 g/mol. Its IUPAC name is 1-fluoro-2,4,6-trimethylpiperazine.
| Compound Name | 1-fluoro-2,4,6-trimethylpiperazine |
|---|---|
| PubChem CID | 165407712 |
| Molecular Formula | C7H15FN2 |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | 1-fluoro-2,4,6-trimethylpiperazine |
| SMILES | CC1CN(C)CC(C)N1F |
| InChI | InChI=1S/C7H15FN2/c1-6-4-9(3)5-7(2)10(6)8/h6-7H,4-5H2,1-3H3 |
| InChIKey | KBQGOJKEHMMPBP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|