C8H12FNO — CID 165408304
N-but-3-en-2-yl-1-fluorocyclopropane-1-carboxamide (PubChem CID 165408304) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is N-but-3-en-2-yl-1-fluorocyclopropane-1-carboxamide.
| Compound Name | N-but-3-en-2-yl-1-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 165408304 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-but-3-en-2-yl-1-fluorocyclopropane-1-carboxamide |
| SMILES | C=CC(C)NC(=O)C1(F)CC1 |
| InChI | InChI=1S/C8H12FNO/c1-3-6(2)10-7(11)8(9)4-5-8/h3,6H,1,4-5H2,2H3,(H,10,11) |
| InChIKey | ABMJDWNAKBFQLU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|