C16H17NO — CID 165409099
[(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine (PubChem CID 165409099) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine.
| Compound Name | [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine |
|---|---|
| PubChem CID | 165409099 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine |
| SMILES | NC[C@H]1CCOc2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C16H17NO/c17-11-13-9-10-18-16-14(7-4-8-15(13)16)12-5-2-1-3-6-12/h1-8,13H,9-11,17H2/t13-/m1/s1 |
| InChIKey | LBNITEMTIWCUMN-CYBMUJFWSA-N |
| XLogP | 3.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |