About [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine
[(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine (PubChem CID 165409099) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine.
Molecular Properties
| Compound Name | [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine |
| PubChem CID | 165409099 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine |
| SMILES | NC[C@H]1CCOc2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C16H17NO/c17-11-13-9-10-18-16-14(7-4-8-15(13)16)12-5-2-1-3-6-12/h1-8,13H,9-11,17H2/t13-/m1/s1 |
| InChIKey | LBNITEMTIWCUMN-CYBMUJFWSA-N |
| XLogP | 3.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine?
The IUPAC name of [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine (CID 165409099) is [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine.
What is the SMILES notation for [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine?
The canonical SMILES for [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine is NC[C@H]1CCOc2c(-c3ccccc3)cccc21.
What is the InChIKey of [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine?
The InChIKey is LBNITEMTIWCUMN-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H17NO/c17-11-13-9-10-18-16-14(7-4-8-15(13)16)12-5-2-1-3-6-12/h1-8,13H,9-11,17H2/t13-/m1/s1.
What are the key properties of [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine?
[(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine has a molecular weight of 239.32 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-8-phenyl-3,4-dihydro-2H-chromen-4-yl]methanamine is sourced from PubChem (CID 165409099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).