C9H12N4O2 — CID 165409465
1-[(12R)-5,11-dioxa-3,7,8-triazatricyclo[6.4.0.02,6]dodeca-1,3,6-trien-12-yl]-N-methylmethanamine (PubChem CID 165409465) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-[(12R)-5,11-dioxa-3,7,8-triazatricyclo[6.4.0.02,6]dodeca-1,3,6-trien-12-yl]-N-methylmethanamine.
| Compound Name | 1-[(12R)-5,11-dioxa-3,7,8-triazatricyclo[6.4.0.02,6]dodeca-1,3,6-trien-12-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 165409465 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-[(12R)-5,11-dioxa-3,7,8-triazatricyclo[6.4.0.02,6]dodeca-1,3,6-trien-12-yl]-N-methylmethanamine |
| SMILES | CNC[C@H]1OCCn2nc3ocnc3c21 |
| InChI | InChI=1S/C9H12N4O2/c1-10-4-6-8-7-9(15-5-11-7)12-13(8)2-3-14-6/h5-6,10H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | YRWVIENFPGGPPF-ZCFIWIBFSA-N |
| XLogP | 0.31 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |