C11H15FN2O3S — CID 165409830
7-fluoro-2,2-dimethyl-4-(sulfamoylamino)-3,4-dihydrochromene (PubChem CID 165409830) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is 7-fluoro-2,2-dimethyl-4-(sulfamoylamino)-3,4-dihydrochromene.
| Compound Name | 7-fluoro-2,2-dimethyl-4-(sulfamoylamino)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 165409830 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 7-fluoro-2,2-dimethyl-4-(sulfamoylamino)-3,4-dihydrochromene |
| SMILES | CC1(C)CC(NS(N)(=O)=O)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C11H15FN2O3S/c1-11(2)6-9(14-18(13,15)16)8-4-3-7(12)5-10(8)17-11/h3-5,9,14H,6H2,1-2H3,(H2,13,15,16) |
| InChIKey | IJLUJJPWBFHKNK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |