C11H12BrFO2 — CID 165409834
3-(2-bromo-5-fluorophenoxy)-2,2-dimethylpropanal (PubChem CID 165409834) has the molecular formula C11H12BrFO2 and a molecular weight of 275.12 g/mol. Its IUPAC name is 3-(2-bromo-5-fluorophenoxy)-2,2-dimethylpropanal.
| Compound Name | 3-(2-bromo-5-fluorophenoxy)-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 165409834 |
| Molecular Formula | C11H12BrFO2 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3-(2-bromo-5-fluorophenoxy)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)COc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H12BrFO2/c1-11(2,6-14)7-15-10-5-8(13)3-4-9(10)12/h3-6H,7H2,1-2H3 |
| InChIKey | KPRAOAUCKRTFPI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|