About 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine
8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine (PubChem CID 165410094) has the molecular formula C13H10ClNO
and a molecular weight of 231.68 g/mol. Its IUPAC name is 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine.
Molecular Properties
| Compound Name | 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine |
| PubChem CID | 165410094 |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine |
| SMILES | Clc1ccc2c(c1)CCc1ncccc1O2 |
| InChI | InChI=1S/C13H10ClNO/c14-10-4-6-12-9(8-10)3-5-11-13(16-12)2-1-7-15-11/h1-2,4,6-8H,3,5H2 |
| InChIKey | FJSOHXINSREAGU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
The IUPAC name of 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine (CID 165410094) is 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine.
What is the SMILES notation for 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
The canonical SMILES for 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine is Clc1ccc2c(c1)CCc1ncccc1O2.
What is the InChIKey of 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
The InChIKey is FJSOHXINSREAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO/c14-10-4-6-12-9(8-10)3-5-11-13(16-12)2-1-7-15-11/h1-2,4,6-8H,3,5H2.
What are the key properties of 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine has a molecular weight of 231.68 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine is sourced from PubChem (CID 165410094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).