About 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine
8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine (PubChem CID 165410285) has the molecular formula C15H17FN2O
and a molecular weight of 260.31 g/mol. Its IUPAC name is 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine.
Molecular Properties
| Compound Name | 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine |
| PubChem CID | 165410285 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine |
| SMILES | CNC.Fc1ccc2c(c1)CCc1ncccc1O2 |
| InChI | InChI=1S/C13H10FNO.C2H7N/c14-10-4-6-12-9(8-10)3-5-11-13(16-12)2-1-7-15-11;1-3-2/h1-2,4,6-8H,3,5H2;3H,1-2H3 |
| InChIKey | KTUCOHIFHFPQDC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine?
The IUPAC name of 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine (CID 165410285) is 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine.
What is the SMILES notation for 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine?
The canonical SMILES for 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine is CNC.Fc1ccc2c(c1)CCc1ncccc1O2.
What is the InChIKey of 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine?
The InChIKey is KTUCOHIFHFPQDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO.C2H7N/c14-10-4-6-12-9(8-10)3-5-11-13(16-12)2-1-7-15-11;1-3-2/h1-2,4,6-8H,3,5H2;3H,1-2H3.
What are the key properties of 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine?
8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine has a molecular weight of 260.31 g/mol, XLogP of 2.95, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine;N-methylmethanamine is sourced from PubChem (CID 165410285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).