N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen

C7H19NO — CID 165411003

IUPACN-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen
SMILESCCNCC(C)(C)OC.[H][H]
InChIInChI=1S/C7H17NO.H2/c1-5-8-6-7(2,3)9-4;/h8H,5-6H2,1-4H3;1H
InChIKeyUJQUWUSLSKACDC-UHFFFAOYSA-N
MW133.24 g/mol
LogP1.27
Rot. Bonds4

About N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen

N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen (PubChem CID 165411003) has the molecular formula C7H19NO and a molecular weight of 133.24 g/mol. Its IUPAC name is N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen.

Molecular Properties

Compound NameN-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen
PubChem CID165411003
Molecular FormulaC7H19NO
Molecular Weight133.24 g/mol
Exact Mass133.15
IUPAC NameN-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen
SMILESCCNCC(C)(C)OC.[H][H]
InChIInChI=1S/C7H17NO.H2/c1-5-8-6-7(2,3)9-4;/h8H,5-6H2,1-4H3;1H
InChIKeyUJQUWUSLSKACDC-UHFFFAOYSA-N
XLogP1.27
TPSA21.26 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.24
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen?
The IUPAC name of N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen (CID 165411003) is N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen.
What is the SMILES notation for N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen?
The canonical SMILES for N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen is CCNCC(C)(C)OC.[H][H].
What is the InChIKey of N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen?
The InChIKey is UJQUWUSLSKACDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.H2/c1-5-8-6-7(2,3)9-4;/h8H,5-6H2,1-4H3;1H.
What are the key properties of N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen?
N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen has a molecular weight of 133.24 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methoxy-2-methylpropan-1-amine;molecular hydrogen is sourced from PubChem (CID 165411003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).